C22H22N2O2 — CID 155278050
(E)-N-[(Z)-3-oxo-1-phenyl-3-pyrrolidin-1-ylprop-1-en-2-yl]-3-phenylprop-2-enamide (PubChem CID 155278050) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is (E)-N-[(Z)-3-oxo-1-phenyl-3-pyrrolidin-1-ylprop-1-en-2-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(Z)-3-oxo-1-phenyl-3-pyrrolidin-1-ylprop-1-en-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 155278050 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (E)-N-[(Z)-3-oxo-1-phenyl-3-pyrrolidin-1-ylprop-1-en-2-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N/C(=C\c1ccccc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C22H22N2O2/c25-21(14-13-18-9-3-1-4-10-18)23-20(17-19-11-5-2-6-12-19)22(26)24-15-7-8-16-24/h1-6,9-14,17H,7-8,15-16H2,(H,23,25)/b14-13+,20-17- |
| InChIKey | FUJTYYUPIGDPRD-GTZCIXAKSA-N |
| XLogP | 3.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|