C14H15NO2 — CID 57310756
4-phenyl-1-pyrrolidin-1-ylbut-3-ene-1,2-dione (PubChem CID 57310756) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-phenyl-1-pyrrolidin-1-ylbut-3-ene-1,2-dione.
| Compound Name | 4-phenyl-1-pyrrolidin-1-ylbut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 57310756 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 4-phenyl-1-pyrrolidin-1-ylbut-3-ene-1,2-dione |
| SMILES | O=C(C=Cc1ccccc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H15NO2/c16-13(14(17)15-10-4-5-11-15)9-8-12-6-2-1-3-7-12/h1-3,6-9H,4-5,10-11H2 |
| InChIKey | IEGJBUVBBUGGGX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|