C22H24N2O2 — CID 155297574
(Z)-N-butan-2-yl-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enamide (PubChem CID 155297574) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (Z)-N-butan-2-yl-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enamide.
| Compound Name | (Z)-N-butan-2-yl-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enamide |
|---|---|
| PubChem CID | 155297574 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (Z)-N-butan-2-yl-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enamide |
| SMILES | CCC(C)NC(=O)/C(=C/c1ccccc1)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H24N2O2/c1-3-17(2)23-22(26)20(16-19-12-8-5-9-13-19)24-21(25)15-14-18-10-6-4-7-11-18/h4-17H,3H2,1-2H3,(H,23,26)(H,24,25)/b15-14+,20-16- |
| InChIKey | SYTCYOCBOGXYIN-WOIMTHDUSA-N |
| XLogP | 3.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|