C19H16O5 — CID 6172846
ethyl (Z)-3-(1,3-benzodioxol-5-yl)-2-benzoylprop-2-enoate (PubChem CID 6172846) has the molecular formula C19H16O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is ethyl (Z)-3-(1,3-benzodioxol-5-yl)-2-benzoylprop-2-enoate.
| Compound Name | ethyl (Z)-3-(1,3-benzodioxol-5-yl)-2-benzoylprop-2-enoate |
|---|---|
| PubChem CID | 6172846 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | ethyl (Z)-3-(1,3-benzodioxol-5-yl)-2-benzoylprop-2-enoate |
| SMILES | CCOC(=O)/C(=C\c1ccc2c(c1)OCO2)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16O5/c1-2-22-19(21)15(18(20)14-6-4-3-5-7-14)10-13-8-9-16-17(11-13)24-12-23-16/h3-11H,2,12H2,1H3/b15-10- |
| InChIKey | KJNXYOIXYJZAHZ-GDNBJRDFSA-N |
| XLogP | 3.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|