C21H22O7 — CID 101412271
ethyl (E)-3-(1,3-benzodioxol-5-yl)-2-(2,3,4-trimethoxyphenyl)prop-2-enoate (PubChem CID 101412271) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is ethyl (E)-3-(1,3-benzodioxol-5-yl)-2-(2,3,4-trimethoxyphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(1,3-benzodioxol-5-yl)-2-(2,3,4-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 101412271 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | ethyl (E)-3-(1,3-benzodioxol-5-yl)-2-(2,3,4-trimethoxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1ccc2c(c1)OCO2)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C21H22O7/c1-5-26-21(22)15(10-13-6-8-16-18(11-13)28-12-27-16)14-7-9-17(23-2)20(25-4)19(14)24-3/h6-11H,5,12H2,1-4H3/b15-10+ |
| InChIKey | JCUSEEHPQKDKBW-XNTDXEJSSA-N |
| XLogP | 3.54 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|