C19H21NO7 — CID 55747447
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2,3,4-trimethoxybenzamide (PubChem CID 55747447) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2,3,4-trimethoxybenzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 55747447 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCOc2ccc3c(c2)OCO3)c(OC)c1OC |
| InChI | InChI=1S/C19H21NO7/c1-22-15-7-5-13(17(23-2)18(15)24-3)19(21)20-8-9-25-12-4-6-14-16(10-12)27-11-26-14/h4-7,10H,8-9,11H2,1-3H3,(H,20,21) |
| InChIKey | BRNHXRAFDAMLKY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|