C19H33Br — CID 177407414
(4Z,6E)-2-bromo-4,5,6-tripropyldeca-1,4,6-triene (PubChem CID 177407414) has the molecular formula C19H33Br and a molecular weight of 341.38 g/mol. Its IUPAC name is (4Z,6E)-2-bromo-4,5,6-tripropyldeca-1,4,6-triene.
| Compound Name | (4Z,6E)-2-bromo-4,5,6-tripropyldeca-1,4,6-triene |
|---|---|
| PubChem CID | 177407414 |
| Molecular Formula | C19H33Br |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (4Z,6E)-2-bromo-4,5,6-tripropyldeca-1,4,6-triene |
| SMILES | C=C(Br)C/C(CCC)=C(CCC)\C(=C\CCC)CCC |
| InChI | InChI=1S/C19H33Br/c1-6-10-14-17(11-7-2)19(13-9-4)18(12-8-3)15-16(5)20/h14H,5-13,15H2,1-4H3/b17-14+,19-18- |
| InChIKey | REIINVKPUJRTCF-KXPRTZDXSA-N |
| XLogP | 7.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|