C17H29N — CID 101430362
(2Z,4E)-2,3,4-tripropylocta-2,4-dienenitrile (PubChem CID 101430362) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is (2Z,4E)-2,3,4-tripropylocta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-2,3,4-tripropylocta-2,4-dienenitrile |
|---|---|
| PubChem CID | 101430362 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | (2Z,4E)-2,3,4-tripropylocta-2,4-dienenitrile |
| SMILES | CCC/C=C(CCC)/C(CCC)=C(\C#N)CCC |
| InChI | InChI=1S/C17H29N/c1-5-9-13-15(10-6-2)17(12-8-4)16(14-18)11-7-3/h13H,5-12H2,1-4H3/b15-13+,17-16- |
| InChIKey | AEJYLXLIOGUNNN-NPALGEPZSA-N |
| XLogP | 5.93 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|