C13H21N — CID 102401969
(2Z,4Z)-2,3-dipropylhepta-2,4-dienenitrile (PubChem CID 102401969) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (2Z,4Z)-2,3-dipropylhepta-2,4-dienenitrile.
| Compound Name | (2Z,4Z)-2,3-dipropylhepta-2,4-dienenitrile |
|---|---|
| PubChem CID | 102401969 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (2Z,4Z)-2,3-dipropylhepta-2,4-dienenitrile |
| SMILES | CC/C=C\C(CCC)=C(/C#N)CCC |
| InChI | InChI=1S/C13H21N/c1-4-7-10-12(8-5-2)13(11-14)9-6-3/h7,10H,4-6,8-9H2,1-3H3/b10-7-,13-12- |
| InChIKey | BCCJXXTWYVPJJC-IUDDKACKSA-N |
| XLogP | 4.37 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|