C17H30 — CID 123891140
5-pentan-2-ylidenedodeca-3,7-diene (PubChem CID 123891140) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 5-pentan-2-ylidenedodeca-3,7-diene.
| Compound Name | 5-pentan-2-ylidenedodeca-3,7-diene |
|---|---|
| PubChem CID | 123891140 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 5-pentan-2-ylidenedodeca-3,7-diene |
| SMILES | CCC=CC(CC=CCCCC)=C(C)CCC |
| InChI | InChI=1S/C17H30/c1-5-8-10-11-12-15-17(14-9-6-2)16(4)13-7-3/h9,11-12,14H,5-8,10,13,15H2,1-4H3 |
| InChIKey | RMPXUIDKLRHNSM-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|