About 2-methylundeca-1,6-diene
2-methylundeca-1,6-diene (PubChem CID 173154459) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is 2-methylundeca-1,6-diene.
Molecular Properties
| Compound Name | 2-methylundeca-1,6-diene |
| PubChem CID | 173154459 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 2-methylundeca-1,6-diene |
| SMILES | C=C(C)CCCC=CCCCC |
| InChI | InChI=1S/C12H22/c1-4-5-6-7-8-9-10-11-12(2)3/h7-8H,2,4-6,9-11H2,1,3H3 |
| InChIKey | IWWPHNNUIQLIJB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylundeca-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylundeca-1,6-diene?
The IUPAC name of 2-methylundeca-1,6-diene (CID 173154459) is 2-methylundeca-1,6-diene.
What is the SMILES notation for 2-methylundeca-1,6-diene?
The canonical SMILES for 2-methylundeca-1,6-diene is C=C(C)CCCC=CCCCC.
What is the InChIKey of 2-methylundeca-1,6-diene?
The InChIKey is IWWPHNNUIQLIJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22/c1-4-5-6-7-8-9-10-11-12(2)3/h7-8H,2,4-6,9-11H2,1,3H3.
What are the key properties of 2-methylundeca-1,6-diene?
2-methylundeca-1,6-diene has a molecular weight of 166.31 g/mol, XLogP of 4.48, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylundeca-1,6-diene is sourced from PubChem (CID 173154459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).