C15H25N — CID 137434733
(2E,4Z)-5-methyl-2,3-dipropylocta-2,4-dienenitrile (PubChem CID 137434733) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is (2E,4Z)-5-methyl-2,3-dipropylocta-2,4-dienenitrile.
| Compound Name | (2E,4Z)-5-methyl-2,3-dipropylocta-2,4-dienenitrile |
|---|---|
| PubChem CID | 137434733 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | (2E,4Z)-5-methyl-2,3-dipropylocta-2,4-dienenitrile |
| SMILES | CCC/C(C)=C\C(CCC)=C(\C#N)CCC |
| InChI | InChI=1S/C15H25N/c1-5-8-13(4)11-14(9-6-2)15(12-16)10-7-3/h11H,5-10H2,1-4H3/b13-11-,15-14+ |
| InChIKey | QMBRVJHAGLCQBF-UNVBMEDASA-N |
| XLogP | 5.15 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|