C11H20 — CID 144603275
(4E)-2,3,5-trimethylocta-2,4-diene (PubChem CID 144603275) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (4E)-2,3,5-trimethylocta-2,4-diene.
| Compound Name | (4E)-2,3,5-trimethylocta-2,4-diene |
|---|---|
| PubChem CID | 144603275 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (4E)-2,3,5-trimethylocta-2,4-diene |
| SMILES | CCC/C(C)=C/C(C)=C(C)C |
| InChI | InChI=1S/C11H20/c1-6-7-10(4)8-11(5)9(2)3/h8H,6-7H2,1-5H3/b10-8+ |
| InChIKey | ASYXNUKHWNJBBR-CSKARUKUSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|