C17H34Si — CID 101455170
[(1E,3E)-2-butyl-3-propylhepta-1,3-dienyl]-trimethylsilane (PubChem CID 101455170) has the molecular formula C17H34Si and a molecular weight of 266.54 g/mol. Its IUPAC name is [(1E,3E)-2-butyl-3-propylhepta-1,3-dienyl]-trimethylsilane.
| Compound Name | [(1E,3E)-2-butyl-3-propylhepta-1,3-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 101455170 |
| Molecular Formula | C17H34Si |
| Molecular Weight | 266.54 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | [(1E,3E)-2-butyl-3-propylhepta-1,3-dienyl]-trimethylsilane |
| SMILES | CCC/C=C(CCC)/C(=C/[Si](C)(C)C)CCCC |
| InChI | InChI=1S/C17H34Si/c1-7-10-13-16(12-9-3)17(14-11-8-2)15-18(4,5)6/h13,15H,7-12,14H2,1-6H3/b16-13+,17-15+ |
| InChIKey | BDHUJJDGIDVEFX-NLEMEUKFSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.54 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|