About lithium (Z)-non-4-en-5-olate
lithium (Z)-non-4-en-5-olate (PubChem CID 23684731) has the molecular formula C9H17LiO
and a molecular weight of 148.17 g/mol. Its IUPAC name is lithium (Z)-non-4-en-5-olate.
Molecular Properties
| Compound Name | lithium (Z)-non-4-en-5-olate |
| PubChem CID | 23684731 |
| Molecular Formula | C9H17LiO |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.14 |
| IUPAC Name | lithium (Z)-non-4-en-5-olate |
| SMILES | CCC/C=C(\[O-])CCCC.[Li+] |
| InChI | InChI=1S/C9H18O.Li/c1-3-5-7-9(10)8-6-4-2;/h7,10H,3-6,8H2,1-2H3;/q;+1/p-1/b9-7-; |
| InChIKey | LMDAUNNHKFIFAQ-VILQZVERSA-M |
| XLogP | -0.78 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze lithium (Z)-non-4-en-5-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium (Z)-non-4-en-5-olate?
The IUPAC name of lithium (Z)-non-4-en-5-olate (CID 23684731) is lithium (Z)-non-4-en-5-olate.
What is the SMILES notation for lithium (Z)-non-4-en-5-olate?
The canonical SMILES for lithium (Z)-non-4-en-5-olate is CCC/C=C(\[O-])CCCC.[Li+].
What is the InChIKey of lithium (Z)-non-4-en-5-olate?
The InChIKey is LMDAUNNHKFIFAQ-VILQZVERSA-M. The full InChI is InChI=1S/C9H18O.Li/c1-3-5-7-9(10)8-6-4-2;/h7,10H,3-6,8H2,1-2H3;/q;+1/p-1/b9-7-;.
What are the key properties of lithium (Z)-non-4-en-5-olate?
lithium (Z)-non-4-en-5-olate has a molecular weight of 148.17 g/mol, XLogP of -0.78, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium (Z)-non-4-en-5-olate is sourced from PubChem (CID 23684731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).