About (E)-2-methylhex-2-enoate;2-methylidenehexanoate
(E)-2-methylhex-2-enoate;2-methylidenehexanoate (PubChem CID 21275729) has the molecular formula C14H22O4-2
and a molecular weight of 254.33 g/mol. Its IUPAC name is (E)-2-methylhex-2-enoate;2-methylidenehexanoate.
Molecular Properties
| Compound Name | (E)-2-methylhex-2-enoate;2-methylidenehexanoate |
| PubChem CID | 21275729 |
| Molecular Formula | C14H22O4-2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (E)-2-methylhex-2-enoate;2-methylidenehexanoate |
| SMILES | C=C(CCCC)C(=O)[O-].CCC/C=C(\C)C(=O)[O-] |
| InChI | InChI=1S/2C7H12O2/c2*1-3-4-5-6(2)7(8)9/h5H,3-4H2,1-2H3,(H,8,9);2-5H2,1H3,(H,8,9)/p-2/b6-5+; |
| InChIKey | ZOSRASCZPDAXTC-IPZCTEOASA-L |
| XLogP | 0.97 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-methylhex-2-enoate;2-methylidenehexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-methylhex-2-enoate;2-methylidenehexanoate?
The IUPAC name of (E)-2-methylhex-2-enoate;2-methylidenehexanoate (CID 21275729) is (E)-2-methylhex-2-enoate;2-methylidenehexanoate.
What is the SMILES notation for (E)-2-methylhex-2-enoate;2-methylidenehexanoate?
The canonical SMILES for (E)-2-methylhex-2-enoate;2-methylidenehexanoate is C=C(CCCC)C(=O)[O-].CCC/C=C(\C)C(=O)[O-].
What is the InChIKey of (E)-2-methylhex-2-enoate;2-methylidenehexanoate?
The InChIKey is ZOSRASCZPDAXTC-IPZCTEOASA-L. The full InChI is InChI=1S/2C7H12O2/c2*1-3-4-5-6(2)7(8)9/h5H,3-4H2,1-2H3,(H,8,9);2-5H2,1H3,(H,8,9)/p-2/b6-5+;.
What are the key properties of (E)-2-methylhex-2-enoate;2-methylidenehexanoate?
(E)-2-methylhex-2-enoate;2-methylidenehexanoate has a molecular weight of 254.33 g/mol, XLogP of 0.97, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-methylhex-2-enoate;2-methylidenehexanoate is sourced from PubChem (CID 21275729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).