C14H20NO4- — CID 20505705
2-ethenyl-4,4-dimethyl-1,3-oxazol-5-one;2-methylidenehexanoate (PubChem CID 20505705) has the molecular formula C14H20NO4- and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-ethenyl-4,4-dimethyl-1,3-oxazol-5-one;2-methylidenehexanoate.
| Compound Name | 2-ethenyl-4,4-dimethyl-1,3-oxazol-5-one;2-methylidenehexanoate |
|---|---|
| PubChem CID | 20505705 |
| Molecular Formula | C14H20NO4- |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-ethenyl-4,4-dimethyl-1,3-oxazol-5-one;2-methylidenehexanoate |
| SMILES | C=C(CCCC)C(=O)[O-].C=CC1=NC(C)(C)C(=O)O1 |
| InChI | InChI=1S/C7H9NO2.C7H12O2/c1-4-5-8-7(2,3)6(9)10-5;1-3-4-5-6(2)7(8)9/h4H,1H2,2-3H3;2-5H2,1H3,(H,8,9)/p-1 |
| InChIKey | WGIQJXKUXYYLBH-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 78.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|