About 2-methylidenehexaneperoxoic acid;prop-1-ene
2-methylidenehexaneperoxoic acid;prop-1-ene (PubChem CID 174973905) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-methylidenehexaneperoxoic acid;prop-1-ene.
Molecular Properties
| Compound Name | 2-methylidenehexaneperoxoic acid;prop-1-ene |
| PubChem CID | 174973905 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-methylidenehexaneperoxoic acid;prop-1-ene |
| SMILES | C=C(CCCC)C(=O)OO.C=CC |
| InChI | InChI=1S/C7H12O3.C3H6/c1-3-4-5-6(2)7(8)10-9;1-3-2/h9H,2-5H2,1H3;3H,1H2,2H3 |
| InChIKey | MLUSWZREKIFTFZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenehexaneperoxoic acid;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenehexaneperoxoic acid;prop-1-ene?
The IUPAC name of 2-methylidenehexaneperoxoic acid;prop-1-ene (CID 174973905) is 2-methylidenehexaneperoxoic acid;prop-1-ene.
What is the SMILES notation for 2-methylidenehexaneperoxoic acid;prop-1-ene?
The canonical SMILES for 2-methylidenehexaneperoxoic acid;prop-1-ene is C=C(CCCC)C(=O)OO.C=CC.
What is the InChIKey of 2-methylidenehexaneperoxoic acid;prop-1-ene?
The InChIKey is MLUSWZREKIFTFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.C3H6/c1-3-4-5-6(2)7(8)10-9;1-3-2/h9H,2-5H2,1H3;3H,1H2,2H3.
What are the key properties of 2-methylidenehexaneperoxoic acid;prop-1-ene?
2-methylidenehexaneperoxoic acid;prop-1-ene has a molecular weight of 186.25 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenehexaneperoxoic acid;prop-1-ene is sourced from PubChem (CID 174973905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).