About 1-cyanoprop-2-enyl 2-methylidenehexanoate
1-cyanoprop-2-enyl 2-methylidenehexanoate (PubChem CID 175322069) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-cyanoprop-2-enyl 2-methylidenehexanoate.
Molecular Properties
| Compound Name | 1-cyanoprop-2-enyl 2-methylidenehexanoate |
| PubChem CID | 175322069 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1-cyanoprop-2-enyl 2-methylidenehexanoate |
| SMILES | C=CC(C#N)OC(=O)C(=C)CCCC |
| InChI | InChI=1S/C11H15NO2/c1-4-6-7-9(3)11(13)14-10(5-2)8-12/h5,10H,2-4,6-7H2,1H3 |
| InChIKey | MUCRLOCXDPKBJX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanoprop-2-enyl 2-methylidenehexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanoprop-2-enyl 2-methylidenehexanoate?
The IUPAC name of 1-cyanoprop-2-enyl 2-methylidenehexanoate (CID 175322069) is 1-cyanoprop-2-enyl 2-methylidenehexanoate.
What is the SMILES notation for 1-cyanoprop-2-enyl 2-methylidenehexanoate?
The canonical SMILES for 1-cyanoprop-2-enyl 2-methylidenehexanoate is C=CC(C#N)OC(=O)C(=C)CCCC.
What is the InChIKey of 1-cyanoprop-2-enyl 2-methylidenehexanoate?
The InChIKey is MUCRLOCXDPKBJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-4-6-7-9(3)11(13)14-10(5-2)8-12/h5,10H,2-4,6-7H2,1H3.
What are the key properties of 1-cyanoprop-2-enyl 2-methylidenehexanoate?
1-cyanoprop-2-enyl 2-methylidenehexanoate has a molecular weight of 193.25 g/mol, XLogP of 2.35, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanoprop-2-enyl 2-methylidenehexanoate is sourced from PubChem (CID 175322069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).