About di(propan-2-yloxy)silyl 2-methylidenehexanoate
di(propan-2-yloxy)silyl 2-methylidenehexanoate (PubChem CID 173111713) has the molecular formula C13H26O4Si
and a molecular weight of 274.43 g/mol. Its IUPAC name is di(propan-2-yloxy)silyl 2-methylidenehexanoate.
Molecular Properties
| Compound Name | di(propan-2-yloxy)silyl 2-methylidenehexanoate |
| PubChem CID | 173111713 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | di(propan-2-yloxy)silyl 2-methylidenehexanoate |
| SMILES | C=C(CCCC)C(=O)O[SiH](OC(C)C)OC(C)C |
| InChI | InChI=1S/C13H26O4Si/c1-7-8-9-12(6)13(14)17-18(15-10(2)3)16-11(4)5/h10-11,18H,6-9H2,1-5H3 |
| InChIKey | FKMKYAWMEYXCMZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze di(propan-2-yloxy)silyl 2-methylidenehexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(propan-2-yloxy)silyl 2-methylidenehexanoate?
The IUPAC name of di(propan-2-yloxy)silyl 2-methylidenehexanoate (CID 173111713) is di(propan-2-yloxy)silyl 2-methylidenehexanoate.
What is the SMILES notation for di(propan-2-yloxy)silyl 2-methylidenehexanoate?
The canonical SMILES for di(propan-2-yloxy)silyl 2-methylidenehexanoate is C=C(CCCC)C(=O)O[SiH](OC(C)C)OC(C)C.
What is the InChIKey of di(propan-2-yloxy)silyl 2-methylidenehexanoate?
The InChIKey is FKMKYAWMEYXCMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O4Si/c1-7-8-9-12(6)13(14)17-18(15-10(2)3)16-11(4)5/h10-11,18H,6-9H2,1-5H3.
What are the key properties of di(propan-2-yloxy)silyl 2-methylidenehexanoate?
di(propan-2-yloxy)silyl 2-methylidenehexanoate has a molecular weight of 274.43 g/mol, XLogP of 2.84, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for di(propan-2-yloxy)silyl 2-methylidenehexanoate is sourced from PubChem (CID 173111713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).