About carboxy 2-methylidenehexanoate
carboxy 2-methylidenehexanoate (PubChem CID 170167153) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is carboxy 2-methylidenehexanoate.
Molecular Properties
| Compound Name | carboxy 2-methylidenehexanoate |
| PubChem CID | 170167153 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | carboxy 2-methylidenehexanoate |
| SMILES | C=C(CCCC)C(=O)OC(=O)O |
| InChI | InChI=1S/C8H12O4/c1-3-4-5-6(2)7(9)12-8(10)11/h2-5H2,1H3,(H,10,11) |
| InChIKey | UTKBNTKAIRVBAK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze carboxy 2-methylidenehexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxy 2-methylidenehexanoate?
The IUPAC name of carboxy 2-methylidenehexanoate (CID 170167153) is carboxy 2-methylidenehexanoate.
What is the SMILES notation for carboxy 2-methylidenehexanoate?
The canonical SMILES for carboxy 2-methylidenehexanoate is C=C(CCCC)C(=O)OC(=O)O.
What is the InChIKey of carboxy 2-methylidenehexanoate?
The InChIKey is UTKBNTKAIRVBAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-3-4-5-6(2)7(9)12-8(10)11/h2-5H2,1H3,(H,10,11).
What are the key properties of carboxy 2-methylidenehexanoate?
carboxy 2-methylidenehexanoate has a molecular weight of 172.18 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carboxy 2-methylidenehexanoate is sourced from PubChem (CID 170167153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).