About O-carboxy pentanethioate
O-carboxy pentanethioate (PubChem CID 141099103) has the molecular formula C6H10O3S
and a molecular weight of 162.21 g/mol. Its IUPAC name is O-carboxy pentanethioate.
Molecular Properties
| Compound Name | O-carboxy pentanethioate |
| PubChem CID | 141099103 |
| Molecular Formula | C6H10O3S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | O-carboxy pentanethioate |
| SMILES | CCCCC(=S)OC(=O)O |
| InChI | InChI=1S/C6H10O3S/c1-2-3-4-5(10)9-6(7)8/h2-4H2,1H3,(H,7,8) |
| InChIKey | UMMHEFHNELQEAW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-carboxy pentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-carboxy pentanethioate?
The IUPAC name of O-carboxy pentanethioate (CID 141099103) is O-carboxy pentanethioate.
What is the SMILES notation for O-carboxy pentanethioate?
The canonical SMILES for O-carboxy pentanethioate is CCCCC(=S)OC(=O)O.
What is the InChIKey of O-carboxy pentanethioate?
The InChIKey is UMMHEFHNELQEAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3S/c1-2-3-4-5(10)9-6(7)8/h2-4H2,1H3,(H,7,8).
What are the key properties of O-carboxy pentanethioate?
O-carboxy pentanethioate has a molecular weight of 162.21 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-carboxy pentanethioate is sourced from PubChem (CID 141099103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).