About azane;carboxy octadecanoate
azane;carboxy octadecanoate (PubChem CID 174916170) has the molecular formula C19H39NO4
and a molecular weight of 345.52 g/mol. Its IUPAC name is azane;carboxy octadecanoate.
Molecular Properties
| Compound Name | azane;carboxy octadecanoate |
| PubChem CID | 174916170 |
| Molecular Formula | C19H39NO4 |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.29 |
| IUPAC Name | azane;carboxy octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OC(=O)O.N |
| InChI | InChI=1S/C19H36O4.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)23-19(21)22;/h2-17H2,1H3,(H,21,22);1H3 |
| InChIKey | VEPQYUSHMCZVRH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze azane;carboxy octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;carboxy octadecanoate?
The IUPAC name of azane;carboxy octadecanoate (CID 174916170) is azane;carboxy octadecanoate.
What is the SMILES notation for azane;carboxy octadecanoate?
The canonical SMILES for azane;carboxy octadecanoate is CCCCCCCCCCCCCCCCCC(=O)OC(=O)O.N.
What is the InChIKey of azane;carboxy octadecanoate?
The InChIKey is VEPQYUSHMCZVRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O4.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)23-19(21)22;/h2-17H2,1H3,(H,21,22);1H3.
What are the key properties of azane;carboxy octadecanoate?
azane;carboxy octadecanoate has a molecular weight of 345.52 g/mol, XLogP of 6.63, 16 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;carboxy octadecanoate is sourced from PubChem (CID 174916170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).