About butoxymethanedithioic acid;propanoic acid
butoxymethanedithioic acid;propanoic acid (PubChem CID 174237104) has the molecular formula C8H16O3S2
and a molecular weight of 224.35 g/mol. Its IUPAC name is butoxymethanedithioic acid;propanoic acid.
Molecular Properties
| Compound Name | butoxymethanedithioic acid;propanoic acid |
| PubChem CID | 174237104 |
| Molecular Formula | C8H16O3S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | butoxymethanedithioic acid;propanoic acid |
| SMILES | CCC(=O)O.CCCCOC(=S)S |
| InChI | InChI=1S/C5H10OS2.C3H6O2/c1-2-3-4-6-5(7)8;1-2-3(4)5/h2-4H2,1H3,(H,7,8);2H2,1H3,(H,4,5) |
| InChIKey | LZTOTRAKXMPTON-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze butoxymethanedithioic acid;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxymethanedithioic acid;propanoic acid?
The IUPAC name of butoxymethanedithioic acid;propanoic acid (CID 174237104) is butoxymethanedithioic acid;propanoic acid.
What is the SMILES notation for butoxymethanedithioic acid;propanoic acid?
The canonical SMILES for butoxymethanedithioic acid;propanoic acid is CCC(=O)O.CCCCOC(=S)S.
What is the InChIKey of butoxymethanedithioic acid;propanoic acid?
The InChIKey is LZTOTRAKXMPTON-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10OS2.C3H6O2/c1-2-3-4-6-5(7)8;1-2-3(4)5/h2-4H2,1H3,(H,7,8);2H2,1H3,(H,4,5).
What are the key properties of butoxymethanedithioic acid;propanoic acid?
butoxymethanedithioic acid;propanoic acid has a molecular weight of 224.35 g/mol, XLogP of 2.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butoxymethanedithioic acid;propanoic acid is sourced from PubChem (CID 174237104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).