About calcium;butoxymethanedithioic acid;hydride
calcium;butoxymethanedithioic acid;hydride (PubChem CID 173442028) has the molecular formula C5H12CaOS2
and a molecular weight of 192.36 g/mol. Its IUPAC name is calcium;butoxymethanedithioic acid;hydride.
Molecular Properties
| Compound Name | calcium;butoxymethanedithioic acid;hydride |
| PubChem CID | 173442028 |
| Molecular Formula | C5H12CaOS2 |
| Molecular Weight | 192.36 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | calcium;butoxymethanedithioic acid;hydride |
| SMILES | CCCCOC(=S)S.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C5H10OS2.Ca.2H/c1-2-3-4-6-5(7)8;;;/h2-4H2,1H3,(H,7,8);;;/q;+2;2*-1 |
| InChIKey | QQYVQTIRFSOPOX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze calcium;butoxymethanedithioic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;butoxymethanedithioic acid;hydride?
The IUPAC name of calcium;butoxymethanedithioic acid;hydride (CID 173442028) is calcium;butoxymethanedithioic acid;hydride.
What is the SMILES notation for calcium;butoxymethanedithioic acid;hydride?
The canonical SMILES for calcium;butoxymethanedithioic acid;hydride is CCCCOC(=S)S.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;butoxymethanedithioic acid;hydride?
The InChIKey is QQYVQTIRFSOPOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10OS2.Ca.2H/c1-2-3-4-6-5(7)8;;;/h2-4H2,1H3,(H,7,8);;;/q;+2;2*-1.
What are the key properties of calcium;butoxymethanedithioic acid;hydride?
calcium;butoxymethanedithioic acid;hydride has a molecular weight of 192.36 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;butoxymethanedithioic acid;hydride is sourced from PubChem (CID 173442028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).