About CID 87972145
CID 87972145 (PubChem CID 87972145) has the molecular formula C13H26KOS2
and a molecular weight of 301.58 g/mol.
Molecular Properties
| Compound Name | CID 87972145 |
| PubChem CID | 87972145 |
| Molecular Formula | C13H26KOS2 |
| Molecular Weight | 301.58 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCCCOC(=S)S.[K] |
| InChI | InChI=1S/C13H26OS2.K/c1-2-3-4-5-6-7-8-9-10-11-12-14-13(15)16;/h2-12H2,1H3,(H,15,16); |
| InChIKey | AWXIXJNJIUZGPL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 87972145 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87972145?
The IUPAC name of CID 87972145 (CID 87972145) is not available.
What is the SMILES notation for CID 87972145?
The canonical SMILES for CID 87972145 is CCCCCCCCCCCCOC(=S)S.[K].
What is the InChIKey of CID 87972145?
The InChIKey is AWXIXJNJIUZGPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26OS2.K/c1-2-3-4-5-6-7-8-9-10-11-12-14-13(15)16;/h2-12H2,1H3,(H,15,16);.
What are the key properties of CID 87972145?
CID 87972145 has a molecular weight of 301.58 g/mol, XLogP of 4.76, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87972145 is sourced from PubChem (CID 87972145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).