About O-dodecyl N-butylcarbamothioate
O-dodecyl N-butylcarbamothioate (PubChem CID 3004093) has the molecular formula C17H35NOS
and a molecular weight of 301.54 g/mol. Its IUPAC name is O-dodecyl N-butylcarbamothioate.
Molecular Properties
| Compound Name | O-dodecyl N-butylcarbamothioate |
| PubChem CID | 3004093 |
| Molecular Formula | C17H35NOS |
| Molecular Weight | 301.54 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | O-dodecyl N-butylcarbamothioate |
| SMILES | CCCCCCCCCCCCOC(=S)NCCCC |
| InChI | InChI=1S/C17H35NOS/c1-3-5-7-8-9-10-11-12-13-14-16-19-17(20)18-15-6-4-2/h3-16H2,1-2H3,(H,18,20) |
| InChIKey | LWIBVTBZOBGYMD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-dodecyl N-butylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-dodecyl N-butylcarbamothioate?
The IUPAC name of O-dodecyl N-butylcarbamothioate (CID 3004093) is O-dodecyl N-butylcarbamothioate.
What is the SMILES notation for O-dodecyl N-butylcarbamothioate?
The canonical SMILES for O-dodecyl N-butylcarbamothioate is CCCCCCCCCCCCOC(=S)NCCCC.
What is the InChIKey of O-dodecyl N-butylcarbamothioate?
The InChIKey is LWIBVTBZOBGYMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NOS/c1-3-5-7-8-9-10-11-12-13-14-16-19-17(20)18-15-6-4-2/h3-16H2,1-2H3,(H,18,20).
What are the key properties of O-dodecyl N-butylcarbamothioate?
O-dodecyl N-butylcarbamothioate has a molecular weight of 301.54 g/mol, XLogP of 5.60, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-dodecyl N-butylcarbamothioate is sourced from PubChem (CID 3004093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).