About calcium;butyl hydrogen carbonate;hydride
calcium;butyl hydrogen carbonate;hydride (PubChem CID 173385932) has the molecular formula C5H12CaO3
and a molecular weight of 160.23 g/mol. Its IUPAC name is calcium;butyl hydrogen carbonate;hydride.
Molecular Properties
| Compound Name | calcium;butyl hydrogen carbonate;hydride |
| PubChem CID | 173385932 |
| Molecular Formula | C5H12CaO3 |
| Molecular Weight | 160.23 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | calcium;butyl hydrogen carbonate;hydride |
| SMILES | CCCCOC(=O)O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C5H10O3.Ca.2H/c1-2-3-4-8-5(6)7;;;/h2-4H2,1H3,(H,6,7);;;/q;+2;2*-1 |
| InChIKey | NBTWSRYGIALIJO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium;butyl hydrogen carbonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;butyl hydrogen carbonate;hydride?
The IUPAC name of calcium;butyl hydrogen carbonate;hydride (CID 173385932) is calcium;butyl hydrogen carbonate;hydride.
What is the SMILES notation for calcium;butyl hydrogen carbonate;hydride?
The canonical SMILES for calcium;butyl hydrogen carbonate;hydride is CCCCOC(=O)O.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;butyl hydrogen carbonate;hydride?
The InChIKey is NBTWSRYGIALIJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.Ca.2H/c1-2-3-4-8-5(6)7;;;/h2-4H2,1H3,(H,6,7);;;/q;+2;2*-1.
What are the key properties of calcium;butyl hydrogen carbonate;hydride?
calcium;butyl hydrogen carbonate;hydride has a molecular weight of 160.23 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;butyl hydrogen carbonate;hydride is sourced from PubChem (CID 173385932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).