About magnesium;dibutyl carbonate;hydride
magnesium;dibutyl carbonate;hydride (PubChem CID 174500135) has the molecular formula C9H20MgO3
and a molecular weight of 200.56 g/mol. Its IUPAC name is magnesium;dibutyl carbonate;hydride.
Molecular Properties
| Compound Name | magnesium;dibutyl carbonate;hydride |
| PubChem CID | 174500135 |
| Molecular Formula | C9H20MgO3 |
| Molecular Weight | 200.56 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | magnesium;dibutyl carbonate;hydride |
| SMILES | CCCCOC(=O)OCCCC.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C9H18O3.Mg.2H/c1-3-5-7-11-9(10)12-8-6-4-2;;;/h3-8H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | LGWWHYXASWGQNR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium;dibutyl carbonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;dibutyl carbonate;hydride?
The IUPAC name of magnesium;dibutyl carbonate;hydride (CID 174500135) is magnesium;dibutyl carbonate;hydride.
What is the SMILES notation for magnesium;dibutyl carbonate;hydride?
The canonical SMILES for magnesium;dibutyl carbonate;hydride is CCCCOC(=O)OCCCC.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;dibutyl carbonate;hydride?
The InChIKey is LGWWHYXASWGQNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3.Mg.2H/c1-3-5-7-11-9(10)12-8-6-4-2;;;/h3-8H2,1-2H3;;;/q;+2;2*-1.
What are the key properties of magnesium;dibutyl carbonate;hydride?
magnesium;dibutyl carbonate;hydride has a molecular weight of 200.56 g/mol, XLogP of 2.58, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;dibutyl carbonate;hydride is sourced from PubChem (CID 174500135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).