About 3-butoxypropyl butyl carbonate
3-butoxypropyl butyl carbonate (PubChem CID 87247588) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is 3-butoxypropyl butyl carbonate.
Molecular Properties
| Compound Name | 3-butoxypropyl butyl carbonate |
| PubChem CID | 87247588 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 3-butoxypropyl butyl carbonate |
| SMILES | CCCCOCCCOC(=O)OCCCC |
| InChI | InChI=1S/C12H24O4/c1-3-5-8-14-9-7-11-16-12(13)15-10-6-4-2/h3-11H2,1-2H3 |
| InChIKey | UOBXIYBHTYTVKI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxypropyl butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxypropyl butyl carbonate?
The IUPAC name of 3-butoxypropyl butyl carbonate (CID 87247588) is 3-butoxypropyl butyl carbonate.
What is the SMILES notation for 3-butoxypropyl butyl carbonate?
The canonical SMILES for 3-butoxypropyl butyl carbonate is CCCCOCCCOC(=O)OCCCC.
What is the InChIKey of 3-butoxypropyl butyl carbonate?
The InChIKey is UOBXIYBHTYTVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O4/c1-3-5-8-14-9-7-11-16-12(13)15-10-6-4-2/h3-11H2,1-2H3.
What are the key properties of 3-butoxypropyl butyl carbonate?
3-butoxypropyl butyl carbonate has a molecular weight of 232.32 g/mol, XLogP of 3.15, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxypropyl butyl carbonate is sourced from PubChem (CID 87247588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).