About tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride
tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride (PubChem CID 174616136) has the molecular formula C11H26Ba4O7
and a molecular weight of 819.63 g/mol. Its IUPAC name is tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride.
Molecular Properties
| Compound Name | tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride |
| PubChem CID | 174616136 |
| Molecular Formula | C11H26Ba4O7 |
| Molecular Weight | 819.63 g/mol |
| Exact Mass | 821.79 |
| IUPAC Name | tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride |
| SMILES | CCCCOC(=O)OC(=O)OC(=O)OCCCC.[Ba+2].[Ba+2].[Ba+2].[Ba+2].[H-].[H-].[H-].[H-].[H-].[H-].[H-].[H-] |
| InChI | InChI=1S/C11H18O7.4Ba.8H/c1-3-5-7-15-9(12)17-11(14)18-10(13)16-8-6-4-2;;;;;;;;;;;;/h3-8H2,1-2H3;;;;;;;;;;;;/q;4*+2;8*-1 |
| InChIKey | URHOTEYEFVZABG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 819.63 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride?
The IUPAC name of tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride (CID 174616136) is tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride.
What is the SMILES notation for tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride?
The canonical SMILES for tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride is CCCCOC(=O)OC(=O)OC(=O)OCCCC.[Ba+2].[Ba+2].[Ba+2].[Ba+2].[H-].[H-].[H-].[H-].[H-].[H-].[H-].[H-].
What is the InChIKey of tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride?
The InChIKey is URHOTEYEFVZABG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O7.4Ba.8H/c1-3-5-7-15-9(12)17-11(14)18-10(13)16-8-6-4-2;;;;;;;;;;;;/h3-8H2,1-2H3;;;;;;;;;;;;/q;4*+2;8*-1.
What are the key properties of tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride?
tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride has a molecular weight of 819.63 g/mol, XLogP of 2.39, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(barium(2+));bis(butoxycarbonyl) carbonate;hydride is sourced from PubChem (CID 174616136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).