About azane;nonyl hydrogen carbonate
azane;nonyl hydrogen carbonate (PubChem CID 175306231) has the molecular formula C10H23NO3
and a molecular weight of 205.30 g/mol. Its IUPAC name is azane;nonyl hydrogen carbonate.
Molecular Properties
| Compound Name | azane;nonyl hydrogen carbonate |
| PubChem CID | 175306231 |
| Molecular Formula | C10H23NO3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | azane;nonyl hydrogen carbonate |
| SMILES | CCCCCCCCCOC(=O)O.N |
| InChI | InChI=1S/C10H20O3.H3N/c1-2-3-4-5-6-7-8-9-13-10(11)12;/h2-9H2,1H3,(H,11,12);1H3 |
| InChIKey | VDZBZSMESPTLSB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;nonyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;nonyl hydrogen carbonate?
The IUPAC name of azane;nonyl hydrogen carbonate (CID 175306231) is azane;nonyl hydrogen carbonate.
What is the SMILES notation for azane;nonyl hydrogen carbonate?
The canonical SMILES for azane;nonyl hydrogen carbonate is CCCCCCCCCOC(=O)O.N.
What is the InChIKey of azane;nonyl hydrogen carbonate?
The InChIKey is VDZBZSMESPTLSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3.H3N/c1-2-3-4-5-6-7-8-9-13-10(11)12;/h2-9H2,1H3,(H,11,12);1H3.
What are the key properties of azane;nonyl hydrogen carbonate?
azane;nonyl hydrogen carbonate has a molecular weight of 205.30 g/mol, XLogP of 3.59, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;nonyl hydrogen carbonate is sourced from PubChem (CID 175306231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).