About 3-butoxy-3-oxopropanoic acid
3-butoxy-3-oxopropanoic acid (PubChem CID 21201188) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is 3-butoxy-3-oxopropanoic acid.
Molecular Properties
| Compound Name | 3-butoxy-3-oxopropanoic acid |
| PubChem CID | 21201188 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 3-butoxy-3-oxopropanoic acid |
| SMILES | CCCCOC(=O)CC(=O)O |
| InChI | InChI=1S/C7H12O4/c1-2-3-4-11-7(10)5-6(8)9/h2-5H2,1H3,(H,8,9) |
| InChIKey | GVISTWYZTBOUJA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-3-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-3-oxopropanoic acid?
The IUPAC name of 3-butoxy-3-oxopropanoic acid (CID 21201188) is 3-butoxy-3-oxopropanoic acid.
What is the SMILES notation for 3-butoxy-3-oxopropanoic acid?
The canonical SMILES for 3-butoxy-3-oxopropanoic acid is CCCCOC(=O)CC(=O)O.
What is the InChIKey of 3-butoxy-3-oxopropanoic acid?
The InChIKey is GVISTWYZTBOUJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-2-3-4-11-7(10)5-6(8)9/h2-5H2,1H3,(H,8,9).
What are the key properties of 3-butoxy-3-oxopropanoic acid?
3-butoxy-3-oxopropanoic acid has a molecular weight of 160.17 g/mol, XLogP of 0.80, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-3-oxopropanoic acid is sourced from PubChem (CID 21201188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).