About butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate
butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate (PubChem CID 134518483) has the molecular formula C19H34O4
and a molecular weight of 326.48 g/mol. Its IUPAC name is butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate.
Molecular Properties
| Compound Name | butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate |
| PubChem CID | 134518483 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate |
| SMILES | C=C(CCC)C(=O)OC(C)C.C=C(CCC)C(=O)OCCCC |
| InChI | InChI=1S/C10H18O2.C9H16O2/c1-4-6-8-12-10(11)9(3)7-5-2;1-5-6-8(4)9(10)11-7(2)3/h3-8H2,1-2H3;7H,4-6H2,1-3H3 |
| InChIKey | SXCUCPQDMUIZSR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate?
The IUPAC name of butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate (CID 134518483) is butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate.
What is the SMILES notation for butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate?
The canonical SMILES for butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate is C=C(CCC)C(=O)OC(C)C.C=C(CCC)C(=O)OCCCC.
What is the InChIKey of butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate?
The InChIKey is SXCUCPQDMUIZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2.C9H16O2/c1-4-6-8-12-10(11)9(3)7-5-2;1-5-6-8(4)9(10)11-7(2)3/h3-8H2,1-2H3;7H,4-6H2,1-3H3.
What are the key properties of butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate?
butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate has a molecular weight of 326.48 g/mol, XLogP of 4.98, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-methylidenepentanoate;propan-2-yl 2-methylidenepentanoate is sourced from PubChem (CID 134518483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).