C10H16O — CID 143941758
3,4-dimethylideneoctan-2-one (PubChem CID 143941758) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 3,4-dimethylideneoctan-2-one.
| Compound Name | 3,4-dimethylideneoctan-2-one |
|---|---|
| PubChem CID | 143941758 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 3,4-dimethylideneoctan-2-one |
| SMILES | C=C(CCCC)C(=C)C(C)=O |
| InChI | InChI=1S/C10H16O/c1-5-6-7-8(2)9(3)10(4)11/h2-3,5-7H2,1,4H3 |
| InChIKey | NUVOWESSXOOXNQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|