About 2-methylidenehexanoylazanide;terbium
2-methylidenehexanoylazanide;terbium (PubChem CID 175783049) has the molecular formula C7H12NOTb-
and a molecular weight of 285.10 g/mol. Its IUPAC name is 2-methylidenehexanoylazanide;terbium.
Molecular Properties
| Compound Name | 2-methylidenehexanoylazanide;terbium |
| PubChem CID | 175783049 |
| Molecular Formula | C7H12NOTb- |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 2-methylidenehexanoylazanide;terbium |
| SMILES | C=C(CCCC)C([NH-])=O.[Tb] |
| InChI | InChI=1S/C7H13NO.Tb/c1-3-4-5-6(2)7(8)9;/h2-5H2,1H3,(H2,8,9);/p-1 |
| InChIKey | PZONLBOWTMQLNG-UHFFFAOYSA-M |
| XLogP | 2.31 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenehexanoylazanide;terbium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenehexanoylazanide;terbium?
The IUPAC name of 2-methylidenehexanoylazanide;terbium (CID 175783049) is 2-methylidenehexanoylazanide;terbium.
What is the SMILES notation for 2-methylidenehexanoylazanide;terbium?
The canonical SMILES for 2-methylidenehexanoylazanide;terbium is C=C(CCCC)C([NH-])=O.[Tb].
What is the InChIKey of 2-methylidenehexanoylazanide;terbium?
The InChIKey is PZONLBOWTMQLNG-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H13NO.Tb/c1-3-4-5-6(2)7(8)9;/h2-5H2,1H3,(H2,8,9);/p-1.
What are the key properties of 2-methylidenehexanoylazanide;terbium?
2-methylidenehexanoylazanide;terbium has a molecular weight of 285.10 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenehexanoylazanide;terbium is sourced from PubChem (CID 175783049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).