C18H33O4- — CID 59271430
(E)-6,10-dihydroxy-2,6,10-trimethylpentadec-2-enoate (PubChem CID 59271430) has the molecular formula C18H33O4- and a molecular weight of 313.46 g/mol. Its IUPAC name is (E)-6,10-dihydroxy-2,6,10-trimethylpentadec-2-enoate.
| Compound Name | (E)-6,10-dihydroxy-2,6,10-trimethylpentadec-2-enoate |
|---|---|
| PubChem CID | 59271430 |
| Molecular Formula | C18H33O4- |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (E)-6,10-dihydroxy-2,6,10-trimethylpentadec-2-enoate |
| SMILES | CCCCCC(C)(O)CCCC(C)(O)CC/C=C(\C)C(=O)[O-] |
| InChI | InChI=1S/C18H34O4/c1-5-6-7-11-17(3,21)13-9-14-18(4,22)12-8-10-15(2)16(19)20/h10,21-22H,5-9,11-14H2,1-4H3,(H,19,20)/p-1/b15-10+ |
| InChIKey | ZXEPEIKSHGYLGY-XNTDXEJSSA-M |
| XLogP | 2.72 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|