About lithium hept-2-en-2-olate
lithium hept-2-en-2-olate (PubChem CID 134859584) has the molecular formula C7H13LiO
and a molecular weight of 120.12 g/mol. Its IUPAC name is lithium hept-2-en-2-olate.
Molecular Properties
| Compound Name | lithium hept-2-en-2-olate |
| PubChem CID | 134859584 |
| Molecular Formula | C7H13LiO |
| Molecular Weight | 120.12 g/mol |
| Exact Mass | 120.11 |
| IUPAC Name | lithium hept-2-en-2-olate |
| SMILES | CCCCC=C(C)[O-].[Li+] |
| InChI | InChI=1S/C7H14O.Li/c1-3-4-5-6-7(2)8;/h6,8H,3-5H2,1-2H3;/q;+1/p-1 |
| InChIKey | BRRAQEKXYAKFFY-UHFFFAOYSA-M |
| XLogP | -1.56 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.12 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze lithium hept-2-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium hept-2-en-2-olate?
The IUPAC name of lithium hept-2-en-2-olate (CID 134859584) is lithium hept-2-en-2-olate.
What is the SMILES notation for lithium hept-2-en-2-olate?
The canonical SMILES for lithium hept-2-en-2-olate is CCCCC=C(C)[O-].[Li+].
What is the InChIKey of lithium hept-2-en-2-olate?
The InChIKey is BRRAQEKXYAKFFY-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H14O.Li/c1-3-4-5-6-7(2)8;/h6,8H,3-5H2,1-2H3;/q;+1/p-1.
What are the key properties of lithium hept-2-en-2-olate?
lithium hept-2-en-2-olate has a molecular weight of 120.12 g/mol, XLogP of -1.56, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium hept-2-en-2-olate is sourced from PubChem (CID 134859584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).