C10H18 — CID 139728618
(2E,4Z)-4-methylnona-2,4-diene (PubChem CID 139728618) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is (2E,4Z)-4-methylnona-2,4-diene.
| Compound Name | (2E,4Z)-4-methylnona-2,4-diene |
|---|---|
| PubChem CID | 139728618 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | (2E,4Z)-4-methylnona-2,4-diene |
| SMILES | C/C=C/C(C)=C\CCCC |
| InChI | InChI=1S/C10H18/c1-4-6-7-9-10(3)8-5-2/h5,8-9H,4,6-7H2,1-3H3/b8-5+,10-9- |
| InChIKey | AEJXYYMEMMSYMF-JVXHAKPFSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|