C12H23N — CID 167054531
(E)-N,N-dimethyl-2-[(Z)-prop-1-enyl]hept-2-en-1-amine (PubChem CID 167054531) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (E)-N,N-dimethyl-2-[(Z)-prop-1-enyl]hept-2-en-1-amine.
| Compound Name | (E)-N,N-dimethyl-2-[(Z)-prop-1-enyl]hept-2-en-1-amine |
|---|---|
| PubChem CID | 167054531 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (E)-N,N-dimethyl-2-[(Z)-prop-1-enyl]hept-2-en-1-amine |
| SMILES | C/C=C\C(=C/CCCC)CN(C)C |
| InChI | InChI=1S/C12H23N/c1-5-7-8-10-12(9-6-2)11-13(3)4/h6,9-10H,5,7-8,11H2,1-4H3/b9-6-,12-10+ |
| InChIKey | VZWUAAIRSGUWDI-QTJHGLNVSA-N |
| XLogP | 3.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|