C16H31P — CID 145156666
[(4Z,6Z)-5-ethylocta-4,6-dienyl]-di(propan-2-yl)phosphane (PubChem CID 145156666) has the molecular formula C16H31P and a molecular weight of 254.40 g/mol. Its IUPAC name is [(4Z,6Z)-5-ethylocta-4,6-dienyl]-di(propan-2-yl)phosphane.
| Compound Name | [(4Z,6Z)-5-ethylocta-4,6-dienyl]-di(propan-2-yl)phosphane |
|---|---|
| PubChem CID | 145156666 |
| Molecular Formula | C16H31P |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | [(4Z,6Z)-5-ethylocta-4,6-dienyl]-di(propan-2-yl)phosphane |
| SMILES | C/C=C\C(=C/CCCP(C(C)C)C(C)C)CC |
| InChI | InChI=1S/C16H31P/c1-7-11-16(8-2)12-9-10-13-17(14(3)4)15(5)6/h7,11-12,14-15H,8-10,13H2,1-6H3/b11-7-,16-12- |
| InChIKey | WXHLMEJHHLIPBH-WDEMQKFBSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|