(1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride

C7H11ClO2S — CID 123215534

IUPAC(1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride
SMILESCC=C/C(=C\S(=O)(=O)Cl)CC
InChIInChI=1S/C7H11ClO2S/c1-3-5-7(4-2)6-11(8,9)10/h3,5-6H,4H2,1-2H3/b5-3?,7-6-
InChIKeyAMRYJFJIILVAMT-YNKXJOLCSA-N
MW194.68 g/mol
LogP2.42
Rot. Bonds3

About (1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride

(1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride (PubChem CID 123215534) has the molecular formula C7H11ClO2S and a molecular weight of 194.68 g/mol. Its IUPAC name is (1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride.

Molecular Properties

Compound Name(1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride
PubChem CID123215534
Molecular FormulaC7H11ClO2S
Molecular Weight194.68 g/mol
Exact Mass194.02
IUPAC Name(1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride
SMILESCC=C/C(=C\S(=O)(=O)Cl)CC
InChIInChI=1S/C7H11ClO2S/c1-3-5-7(4-2)6-11(8,9)10/h3,5-6H,4H2,1-2H3/b5-3?,7-6-
InChIKeyAMRYJFJIILVAMT-YNKXJOLCSA-N
XLogP2.42
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.68
LogP ≤ 52.42
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride?
The IUPAC name of (1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride (CID 123215534) is (1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride.
What is the SMILES notation for (1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride?
The canonical SMILES for (1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride is CC=C/C(=C\S(=O)(=O)Cl)CC.
What is the InChIKey of (1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride?
The InChIKey is AMRYJFJIILVAMT-YNKXJOLCSA-N. The full InChI is InChI=1S/C7H11ClO2S/c1-3-5-7(4-2)6-11(8,9)10/h3,5-6H,4H2,1-2H3/b5-3?,7-6-.
What are the key properties of (1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride?
(1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride has a molecular weight of 194.68 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-2-ethylpenta-1,3-diene-1-sulfonyl chloride is sourced from PubChem (CID 123215534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).