C8H11ClO — CID 15719472
(4Z,6E)-5-chloroocta-4,6-dien-3-one (PubChem CID 15719472) has the molecular formula C8H11ClO and a molecular weight of 158.63 g/mol. Its IUPAC name is (4Z,6E)-5-chloroocta-4,6-dien-3-one.
| Compound Name | (4Z,6E)-5-chloroocta-4,6-dien-3-one |
|---|---|
| PubChem CID | 15719472 |
| Molecular Formula | C8H11ClO |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | (4Z,6E)-5-chloroocta-4,6-dien-3-one |
| SMILES | C/C=C/C(Cl)=C/C(=O)CC |
| InChI | InChI=1S/C8H11ClO/c1-3-5-7(9)6-8(10)4-2/h3,5-6H,4H2,1-2H3/b5-3+,7-6- |
| InChIKey | GDFHINMMYKXCJZ-WZWXSLMZSA-N |
| XLogP | 2.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|