About (Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene
(Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene (PubChem CID 178015163) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is (Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene.
Molecular Properties
| Compound Name | (Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene |
| PubChem CID | 178015163 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene |
| SMILES | C/C=C\C.CCC(=O)/C=C(\N)CC |
| InChI | InChI=1S/C7H13NO.C4H8/c1-3-6(8)5-7(9)4-2;1-3-4-2/h5H,3-4,8H2,1-2H3;3-4H,1-2H3/b6-5-;4-3- |
| InChIKey | RTZPUHXZMQVCAN-YCMZMBCZSA-N |
| XLogP | 2.80 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene?
The IUPAC name of (Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene (CID 178015163) is (Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene.
What is the SMILES notation for (Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene?
The canonical SMILES for (Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene is C/C=C\C.CCC(=O)/C=C(\N)CC.
What is the InChIKey of (Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene?
The InChIKey is RTZPUHXZMQVCAN-YCMZMBCZSA-N. The full InChI is InChI=1S/C7H13NO.C4H8/c1-3-6(8)5-7(9)4-2;1-3-4-2/h5H,3-4,8H2,1-2H3;3-4H,1-2H3/b6-5-;4-3-.
What are the key properties of (Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene?
(Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene has a molecular weight of 183.29 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-aminohept-4-en-3-one;(Z)-but-2-ene is sourced from PubChem (CID 178015163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).