C6H12N2S — CID 146393049
(1E,3Z)-2,4-diaminohexa-1,3-diene-1-thiol (PubChem CID 146393049) has the molecular formula C6H12N2S and a molecular weight of 144.24 g/mol. Its IUPAC name is (1E,3Z)-2,4-diaminohexa-1,3-diene-1-thiol.
| Compound Name | (1E,3Z)-2,4-diaminohexa-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 146393049 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | (1E,3Z)-2,4-diaminohexa-1,3-diene-1-thiol |
| SMILES | CC/C(N)=C/C(N)=C\S |
| InChI | InChI=1S/C6H12N2S/c1-2-5(7)3-6(8)4-9/h3-4,9H,2,7-8H2,1H3/b5-3-,6-4+ |
| InChIKey | DPDOHNNPOKYFFJ-CIIODKQPSA-N |
| XLogP | 0.97 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|