C10H20N2 — CID 165143010
(Z)-5-imino-6,6-dimethyloct-3-en-3-amine (PubChem CID 165143010) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (Z)-5-imino-6,6-dimethyloct-3-en-3-amine.
| Compound Name | (Z)-5-imino-6,6-dimethyloct-3-en-3-amine |
|---|---|
| PubChem CID | 165143010 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (Z)-5-imino-6,6-dimethyloct-3-en-3-amine |
| SMILES | [H]/N=C(\C=C(/N)CC)C(C)(C)CC |
| InChI | InChI=1S/C10H20N2/c1-5-8(11)7-9(12)10(3,4)6-2/h7,12H,5-6,11H2,1-4H3/b8-7-,12-9+ |
| InChIKey | KWXZNCZELXQETM-HVTAIUIQSA-N |
| XLogP | 2.69 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|