About methanamine;propanimidamide
methanamine;propanimidamide (PubChem CID 158653796) has the molecular formula C4H13N3
and a molecular weight of 103.17 g/mol. Its IUPAC name is methanamine;propanimidamide.
Molecular Properties
| Compound Name | methanamine;propanimidamide |
| PubChem CID | 158653796 |
| Molecular Formula | C4H13N3 |
| Molecular Weight | 103.17 g/mol |
| Exact Mass | 103.11 |
| IUPAC Name | methanamine;propanimidamide |
| SMILES | CN.[H]/N=C(/N)CC |
| InChI | InChI=1S/C3H8N2.CH5N/c1-2-3(4)5;1-2/h2H2,1H3,(H3,4,5);2H2,1H3 |
| InChIKey | IBWLQRHONHGCHA-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.17 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methanamine;propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;propanimidamide?
The IUPAC name of methanamine;propanimidamide (CID 158653796) is methanamine;propanimidamide.
What is the SMILES notation for methanamine;propanimidamide?
The canonical SMILES for methanamine;propanimidamide is CN.[H]/N=C(/N)CC.
What is the InChIKey of methanamine;propanimidamide?
The InChIKey is IBWLQRHONHGCHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2.CH5N/c1-2-3(4)5;1-2/h2H2,1H3,(H3,4,5);2H2,1H3.
What are the key properties of methanamine;propanimidamide?
methanamine;propanimidamide has a molecular weight of 103.17 g/mol, XLogP of -0.09, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;propanimidamide is sourced from PubChem (CID 158653796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).