C6H16ClN3O — CID 160949006
N,N-dimethylformamide;propanimidamide;hydrochloride (PubChem CID 160949006) has the molecular formula C6H16ClN3O and a molecular weight of 181.67 g/mol. Its IUPAC name is N,N-dimethylformamide;propanimidamide;hydrochloride.
| Compound Name | N,N-dimethylformamide;propanimidamide;hydrochloride |
|---|---|
| PubChem CID | 160949006 |
| Molecular Formula | C6H16ClN3O |
| Molecular Weight | 181.67 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | N,N-dimethylformamide;propanimidamide;hydrochloride |
| SMILES | CN(C)C=O.Cl.[H]/N=C(/N)CC |
| InChI | InChI=1S/C3H8N2.C3H7NO.ClH/c1-2-3(4)5;1-4(2)3-5;/h2H2,1H3,(H3,4,5);3H,1-2H3;1H |
| InChIKey | SXCSNQJCXDOUQF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.67 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|