About N,N-dimethylformamide;propanimidamide;hydrochloride
N,N-dimethylformamide;propanimidamide;hydrochloride (PubChem CID 160949006) has the molecular formula C6H16ClN3O
and a molecular weight of 181.67 g/mol. Its IUPAC name is N,N-dimethylformamide;propanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N,N-dimethylformamide;propanimidamide;hydrochloride |
| PubChem CID | 160949006 |
| Molecular Formula | C6H16ClN3O |
| Molecular Weight | 181.67 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | N,N-dimethylformamide;propanimidamide;hydrochloride |
| SMILES | CN(C)C=O.Cl.[H]/N=C(/N)CC |
| InChI | InChI=1S/C3H8N2.C3H7NO.ClH/c1-2-3(4)5;1-4(2)3-5;/h2H2,1H3,(H3,4,5);3H,1-2H3;1H |
| InChIKey | SXCSNQJCXDOUQF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.67 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;propanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;propanimidamide;hydrochloride?
The IUPAC name of N,N-dimethylformamide;propanimidamide;hydrochloride (CID 160949006) is N,N-dimethylformamide;propanimidamide;hydrochloride.
What is the SMILES notation for N,N-dimethylformamide;propanimidamide;hydrochloride?
The canonical SMILES for N,N-dimethylformamide;propanimidamide;hydrochloride is CN(C)C=O.Cl.[H]/N=C(/N)CC.
What is the InChIKey of N,N-dimethylformamide;propanimidamide;hydrochloride?
The InChIKey is SXCSNQJCXDOUQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2.C3H7NO.ClH/c1-2-3(4)5;1-4(2)3-5;/h2H2,1H3,(H3,4,5);3H,1-2H3;1H.
What are the key properties of N,N-dimethylformamide;propanimidamide;hydrochloride?
N,N-dimethylformamide;propanimidamide;hydrochloride has a molecular weight of 181.67 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;propanimidamide;hydrochloride is sourced from PubChem (CID 160949006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).