C9H20N2O2 — CID 118917996
N,N-dimethylformamide;2-ethylbutanamide (PubChem CID 118917996) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N,N-dimethylformamide;2-ethylbutanamide.
| Compound Name | N,N-dimethylformamide;2-ethylbutanamide |
|---|---|
| PubChem CID | 118917996 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | N,N-dimethylformamide;2-ethylbutanamide |
| SMILES | CCC(CC)C(N)=O.CN(C)C=O |
| InChI | InChI=1S/C6H13NO.C3H7NO/c1-3-5(4-2)6(7)8;1-4(2)3-5/h5H,3-4H2,1-2H3,(H2,7,8);3H,1-2H3 |
| InChIKey | LNOOKGVPUFKVRC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|