About 3-ethyl-2-oxopentanamide
3-ethyl-2-oxopentanamide (PubChem CID 21120726) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 3-ethyl-2-oxopentanamide.
Molecular Properties
| Compound Name | 3-ethyl-2-oxopentanamide |
| PubChem CID | 21120726 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 3-ethyl-2-oxopentanamide |
| SMILES | CCC(CC)C(=O)C(N)=O |
| InChI | InChI=1S/C7H13NO2/c1-3-5(4-2)6(9)7(8)10/h5H,3-4H2,1-2H3,(H2,8,10) |
| InChIKey | VHFNYXPRTBZCLR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-oxopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-oxopentanamide?
The IUPAC name of 3-ethyl-2-oxopentanamide (CID 21120726) is 3-ethyl-2-oxopentanamide.
What is the SMILES notation for 3-ethyl-2-oxopentanamide?
The canonical SMILES for 3-ethyl-2-oxopentanamide is CCC(CC)C(=O)C(N)=O.
What is the InChIKey of 3-ethyl-2-oxopentanamide?
The InChIKey is VHFNYXPRTBZCLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-3-5(4-2)6(9)7(8)10/h5H,3-4H2,1-2H3,(H2,8,10).
What are the key properties of 3-ethyl-2-oxopentanamide?
3-ethyl-2-oxopentanamide has a molecular weight of 143.19 g/mol, XLogP of 0.48, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-oxopentanamide is sourced from PubChem (CID 21120726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).